Difference between revisions of "SJ06922"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] == * common-name: ** 6-hydroxy-2-cyclohexen-one-carboxylate * smiles: ** c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13888 CPD-13888] == * common-name: ** (25s)-26-oxocholest-4-en-3-one * smiles: ** cc([ch]=o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13888 CPD-13888] ==
 
* common-name:
 
* common-name:
** 6-hydroxy-2-cyclohexen-one-carboxylate
+
** (25s)-26-oxocholest-4-en-3-one
 
* smiles:
 
* smiles:
** c(=o)(c1(o)(c=cccc(=o)1))[o-]
+
** cc([ch]=o)cccc(c)[ch]3(cc[ch]4([ch]2(ccc1(=cc(=o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** wezwwzkubqcmbl-uhfffaoysa-m
+
** bggfpzprxrjkgg-nyjsjaolsa-n
 
* molecular-weight:
 
* molecular-weight:
** 155.13
+
** 398.628
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12849]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12252]]
+
* [[RXN-12850]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-hydroxy-2-cyclohexen-one-carboxylate}}
+
{{#set: common-name=(25s)-26-oxocholest-4-en-3-one}}
{{#set: inchi-key=inchikey=wezwwzkubqcmbl-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=bggfpzprxrjkgg-nyjsjaolsa-n}}
{{#set: molecular-weight=155.13}}
+
{{#set: molecular-weight=398.628}}

Revision as of 09:23, 27 August 2019

Metabolite CPD-13888

  • common-name:
    • (25s)-26-oxocholest-4-en-3-one
  • smiles:
    • cc([ch]=o)cccc(c)[ch]3(cc[ch]4([ch]2(ccc1(=cc(=o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • bggfpzprxrjkgg-nyjsjaolsa-n
  • molecular-weight:
    • 398.628

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality