Difference between revisions of "SJ06944"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11412 CPD-11412] == * common-name: ** triiodothyroacetate ester glucuronide * smiles: ** c(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Hydroxyglutaryl-ACP-methyl-ester 3-Hydroxyglutaryl-ACP-methyl-ester] == * common-name: ** a (...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11412 CPD-11412] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Hydroxyglutaryl-ACP-methyl-ester 3-Hydroxyglutaryl-ACP-methyl-ester] ==
 
* common-name:
 
* common-name:
** triiodothyroacetate ester glucuronide
+
** a (3r)-3-hydroxyglutaryl-[acp] methyl ester
* smiles:
 
** c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(c=c(i)c(=c(i)c=2)oc3(=cc(i)=c(o)c=c3))
 
* inchi-key:
 
** fpejnmnxcsitjo-kfyubchvsa-m
 
* molecular-weight:
 
** 797.054
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-11477]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10618]]
+
* [[RXN-11476]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=triiodothyroacetate ester glucuronide}}
+
{{#set: common-name=a (3r)-3-hydroxyglutaryl-[acp] methyl ester}}
{{#set: inchi-key=inchikey=fpejnmnxcsitjo-kfyubchvsa-m}}
 
{{#set: molecular-weight=797.054}}
 

Revision as of 09:24, 27 August 2019

Metabolite 3-Hydroxyglutaryl-ACP-methyl-ester

  • common-name:
    • a (3r)-3-hydroxyglutaryl-[acp] methyl ester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a (3r)-3-hydroxyglutaryl-[acp] methyl ester" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.