Difference between revisions of "SJ06984"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLC-6-P ALPHA-GLC-6-P] == * common-name: ** α-d-glucose 6-phosphate * smiles: ** c(...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OLEOYL-COA OLEOYL-COA] == * common-name: ** oleoyl-coa * smiles: ** ccccccccc=ccccccccc(=o)sccn...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OLEOYL-COA OLEOYL-COA] == |
* common-name: | * common-name: | ||
| − | ** | + | ** oleoyl-coa |
* smiles: | * smiles: | ||
| − | ** c(op(=o)([o-])[o-]) | + | ** ccccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xduhqpoxluavee-bpmmelmssa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 1027.953 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-13322]] |
| − | * [[ | + | * [[RXN-15036]] |
| − | * [[ | + | * [[RXN-15043]] |
| − | * [[ | + | * [[RXN-15044]] |
| − | * [[ | + | * [[RXN-15045]] |
| − | * [[ | + | * [[RXN-15090]] |
| − | * [[ | + | * [[RXN-17775]] |
| − | * [[ | + | * [[RXN-9601]] |
| − | * [[RXN- | + | * [[RXN-9666]] |
| − | * [[ | + | * [[RXN-9670]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[1.14.19.1-RXN]] |
| − | + | * [[RXN-15036]] | |
| − | * [[ | + | * [[RXN-9644]] |
| − | * [[ | + | * [[RXN-9670]] |
| − | * [[ | + | * [[RXN0-7239]] |
| − | * [[ | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=oleoyl-coa}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xduhqpoxluavee-bpmmelmssa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=1027.953}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite OLEOYL-COA
- common-name:
- oleoyl-coa
- smiles:
- ccccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- xduhqpoxluavee-bpmmelmssa-j
- molecular-weight:
- 1027.953
