Difference between revisions of "SJ07018"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4617 CPD-4617] == * common-name: ** dihydrozeatin-o-glucoside * smiles: ** cc(ccnc1(c2(=c(n...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13670 CPD-13670] == * common-name: ** 30-hydroxy-11-oxo-β-amyrin * smiles: ** cc1(c(cc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13670 CPD-13670] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 30-hydroxy-11-oxo-β-amyrin |
* smiles: | * smiles: | ||
| − | ** | + | ** cc1(c(ccc2(c3(c(ccc12)(c4(c(=cc(=o)3)c5(c(cc4)(ccc(c5)(co)c)c))c)c))c)o)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** jcgxiyqlryphdg-zbyjljtqsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 456.707 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-13493]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-13492]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=30-hydroxy-11-oxo-β-amyrin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jcgxiyqlryphdg-zbyjljtqsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=456.707}} |
Revision as of 09:23, 27 August 2019
Contents
Metabolite CPD-13670
- common-name:
- 30-hydroxy-11-oxo-β-amyrin
- smiles:
- cc1(c(ccc2(c3(c(ccc12)(c4(c(=cc(=o)3)c5(c(cc4)(ccc(c5)(co)c)c))c)c))c)o)c
- inchi-key:
- jcgxiyqlryphdg-zbyjljtqsa-n
- molecular-weight:
- 456.707
