Difference between revisions of "SJ07024"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12119 CPD-12119] == * common-name: ** demethylmenaquinol-10 * smiles: ** cc(=cccc(=cccc(c)=...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P3I P3I] == * common-name: ** pppi * smiles: ** [o-]p(op(=o)(op([o-])(=o)[o-])[o-])([o-])=o * i...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12119 CPD-12119] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P3I P3I] ==
 
* common-name:
 
* common-name:
** demethylmenaquinol-10
+
** pppi
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c
+
** [o-]p(op(=o)(op([o-])(=o)[o-])[o-])([o-])=o
 
* inchi-key:
 
* inchi-key:
** fnbtzsjwsslppl-alcxcgrtsa-n
+
** unxrwkveancorm-uhfffaoysa-i
 
* molecular-weight:
 
* molecular-weight:
** 841.354
+
** 252.915
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9361]]
+
* [[TRIPHOSPHATASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[4.2.3.12-RXN]]
 +
* [[BTUR2-RXN]]
 +
* [[COBALADENOSYLTRANS-RXN]]
 +
* [[DGTPTRIPHYDRO-RXN]]
 +
* [[R344-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=demethylmenaquinol-10}}
+
{{#set: common-name=pppi}}
{{#set: inchi-key=inchikey=fnbtzsjwsslppl-alcxcgrtsa-n}}
+
{{#set: inchi-key=inchikey=unxrwkveancorm-uhfffaoysa-i}}
{{#set: molecular-weight=841.354}}
+
{{#set: molecular-weight=252.915}}

Revision as of 09:23, 27 August 2019

Metabolite P3I

  • common-name:
    • pppi
  • smiles:
    • [o-]p(op(=o)(op([o-])(=o)[o-])[o-])([o-])=o
  • inchi-key:
    • unxrwkveancorm-uhfffaoysa-i
  • molecular-weight:
    • 252.915

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality