Difference between revisions of "SJ07093"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15913 CPD-15913] == * common-name: ** aurachin c epoxide * smiles: ** cc(c)=cccc(c)=cccc(c)...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NA+ NA+] == * common-name: ** na+ * smiles: ** [na+] * inchi-key: ** fknqfgjonoiptf-uhfffaoysa-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15913 CPD-15913] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NA+ NA+] ==
 
* common-name:
 
* common-name:
** aurachin c epoxide
+
** na+
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)=cccc(c)=ccc12(oc(c)1n(c3(c=cc=cc(c2=o)=3))o)
+
** [na+]
 
* inchi-key:
 
* inchi-key:
** forhhprbeftlrm-yefhwucqsa-n
+
** fknqfgjonoiptf-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 395.541
+
** 22.99
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3.6.3.9-RXN]]
 +
* [[ExchangeSeed-NA+]]
 +
* [[PINA1th]]
 +
* [[PINA1tm]]
 +
* [[TRANS-RXN-101]]
 +
* [[TransportSeed-NA+]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15029]]
+
* [[3.6.3.9-RXN]]
 +
* [[ExchangeSeed-NA+]]
 +
* [[PINA1th]]
 +
* [[PINA1tm]]
 +
* [[TRANS-RXN-101]]
 +
* [[TransportSeed-NA+]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=aurachin c epoxide}}
+
{{#set: common-name=na+}}
{{#set: inchi-key=inchikey=forhhprbeftlrm-yefhwucqsa-n}}
+
{{#set: inchi-key=inchikey=fknqfgjonoiptf-uhfffaoysa-n}}
{{#set: molecular-weight=395.541}}
+
{{#set: molecular-weight=22.99}}

Revision as of 09:24, 27 August 2019

Metabolite NA+

  • common-name:
    • na+
  • smiles:
    • [na+]
  • inchi-key:
    • fknqfgjonoiptf-uhfffaoysa-n
  • molecular-weight:
    • 22.99

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality