Difference between revisions of "SJ07151"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-METHYL-RS-TETRAHYDROBENZYLISOQUINOL N-METHYL-RS-TETRAHYDROBENZYLISOQUINOL] == * common-name:...")
(Created page with "Category:gene == Gene SJ07151 == * transcription-direction: ** positive * right-end-position: ** 11302 * left-end-position: ** 1305 * centisome-position: ** 1.8724442...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-METHYL-RS-TETRAHYDROBENZYLISOQUINOL N-METHYL-RS-TETRAHYDROBENZYLISOQUINOL] ==
+
== Gene SJ07151 ==
−
* common-name:
+
* transcription-direction:
−
** n-methyl-(r,s)-tetrahydrobenzylisoquinoline
+
** positive
−
* smiles:
+
* right-end-position:
−
** c[n+]1(c(c2(c(cc1)=cc=cc=2))cc3(c=cc=cc=3))
+
** 11302
−
* inchi-key:
+
* left-end-position:
−
** vkrkvllltihdef-uhfffaoysa-o
+
** 1305
−
* molecular-weight:
+
* centisome-position:
−
** 238.352
+
** 1.8724442   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_carotenoid_curated]]
−
* [[2.1.1.115-RXN]]
+
== Reaction(s) associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[XYLULOKIN-RXN]]
−
{{#set: common-name=n-methyl-(r,s)-tetrahydrobenzylisoquinoline}}
+
** Category: [[annotation]]
−
{{#set: inchi-key=inchikey=vkrkvllltihdef-uhfffaoysa-o}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: molecular-weight=238.352}}
+
== Pathway(s) associated ==
 +
* [[DARABITOLUTIL-PWY]]
 +
** '''1''' reactions found over '''2''' reactions in the full pathway
 +
* [[LARABITOLUTIL-PWY]]
 +
** '''1''' reactions found over '''2''' reactions in the full pathway
 +
* [[XYLCAT-PWY]]
 +
** '''1''' reactions found over '''2''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=11302}}
 +
{{#set: left-end-position=1305}}
 +
{{#set: centisome-position=1.8724442    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=3}}

Latest revision as of 11:01, 18 March 2021

Gene SJ07151

  • transcription-direction:
    • positive
  • right-end-position:
    • 11302
  • left-end-position:
    • 1305
  • centisome-position:
    • 1.8724442

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ07151&oldid=132191"