Difference between revisions of "SJ07151"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMMONIA AMMONIA] == * common-name: ** ammonia * smiles: ** [nh3] * inchi-key: ** qgzkdvfqnngyky...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-METHYL-RS-TETRAHYDROBENZYLISOQUINOL N-METHYL-RS-TETRAHYDROBENZYLISOQUINOL] == * common-name:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-METHYL-RS-TETRAHYDROBENZYLISOQUINOL N-METHYL-RS-TETRAHYDROBENZYLISOQUINOL] == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-methyl-(r,s)-tetrahydrobenzylisoquinoline |
* smiles: | * smiles: | ||
| − | ** [ | + | ** c[n+]1(c(c2(c(cc1)=cc=cc=2))cc3(c=cc=cc=3)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** vkrkvllltihdef-uhfffaoysa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 238.352 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.1.1.115-RXN]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-methyl-(r,s)-tetrahydrobenzylisoquinoline}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vkrkvllltihdef-uhfffaoysa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=238.352}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite N-METHYL-RS-TETRAHYDROBENZYLISOQUINOL
- common-name:
- n-methyl-(r,s)-tetrahydrobenzylisoquinoline
- smiles:
- c[n+]1(c(c2(c(cc1)=cc=cc=2))cc3(c=cc=cc=3))
- inchi-key:
- vkrkvllltihdef-uhfffaoysa-o
- molecular-weight:
- 238.352
