Difference between revisions of "SJ07151"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-METHYL-RS-TETRAHYDROBENZYLISOQUINOL N-METHYL-RS-TETRAHYDROBENZYLISOQUINOL] == * common-name:...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-phosphatidyl-inositols L-1-phosphatidyl-inositols] == * common-name: ** a 1-phosphatidyl-1d...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-METHYL-RS-TETRAHYDROBENZYLISOQUINOL N-METHYL-RS-TETRAHYDROBENZYLISOQUINOL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-phosphatidyl-inositols L-1-phosphatidyl-inositols] ==
 
* common-name:
 
* common-name:
** n-methyl-(r,s)-tetrahydrobenzylisoquinoline
+
** a 1-phosphatidyl-1d-myo-inositol
* smiles:
 
** c[n+]1(c(c2(c(cc1)=cc=cc=2))cc3(c=cc=cc=3))
 
* inchi-key:
 
** vkrkvllltihdef-uhfffaoysa-o
 
* molecular-weight:
 
** 238.352
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[1-PHOSPHATIDYLINOSITOL-3-KINASE-RXN]]
 +
* [[1-PHOSPHATIDYLINOSITOL-KINASE-RXN]]
 +
* [[2.4.1.198-RXN]]
 +
* [[3.1.4.10-RXN]]
 +
* [[RXN-16261]]
 +
* [[RXN3O-581]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.1.1.115-RXN]]
+
* [[2.4.1.198-RXN]]
 +
* [[2.7.8.11-RXN]]
 +
* [[3.1.4.10-RXN]]
 +
* [[PHOSPHATIDYLINOSITOL-3-PHOSPHATASE-RXN]]
 +
* [[RXN-16261]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-methyl-(r,s)-tetrahydrobenzylisoquinoline}}
+
{{#set: common-name=a 1-phosphatidyl-1d-myo-inositol}}
{{#set: inchi-key=inchikey=vkrkvllltihdef-uhfffaoysa-o}}
 
{{#set: molecular-weight=238.352}}
 

Revision as of 09:24, 27 August 2019