Difference between revisions of "SJ07160"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-90 CPD1F-90] == * common-name: ** kaempferol * smiles: ** c3(c=c(o)c=cc(c1(=c([o-])c(=o)c...")
(Created page with "Category:gene == Gene SJ07160 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * DIHYDRONEOPTERIN-MONO-P-...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-90 CPD1F-90] ==
+
== Gene SJ07160 ==
* common-name:
+
== Organism(s) associated with this gene  ==
** kaempferol
+
* [[S.japonica_carotenoid_curated]]
* smiles:
+
== Reaction(s) associated ==
** c3(c=c(o)c=cc(c1(=c([o-])c(=o)c2(c(o)=cc(o)=cc(o1)=2)))=3)
+
* [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]]
* inchi-key:
+
** Category: [[orthology]]
** iyrmwmyzsqpjkc-uhfffaoysa-m
+
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
* molecular-weight:
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
** 285.232
+
* [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]]
== Reaction(s) known to consume the compound ==
+
** Category: [[orthology]]
* [[RXN-12510]]
+
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
* [[RXN-13935]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* [[RXN1F-461]]
+
== Pathway(s) associated ==
== Reaction(s) known to produce the compound ==
+
* [[PWY-7539]]
* [[RXN1F-93]]
+
** '''4''' reactions found over '''5''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[PWY-6797]]
{{#set: common-name=kaempferol}}
+
** '''3''' reactions found over '''7''' reactions in the full pathway
{{#set: inchi-key=inchikey=iyrmwmyzsqpjkc-uhfffaoysa-m}}
+
* [[PWY-6147]]
{{#set: molecular-weight=285.232}}
+
** '''5''' reactions found over '''5''' reactions in the full pathway
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=3}}

Latest revision as of 11:03, 18 March 2021

Gene SJ07160

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7539
    • 4 reactions found over 5 reactions in the full pathway
  • PWY-6797
    • 3 reactions found over 7 reactions in the full pathway
  • PWY-6147
    • 5 reactions found over 5 reactions in the full pathway