Difference between revisions of "SJ07160"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-90 CPD1F-90] == * common-name: ** kaempferol * smiles: ** c3(c=c(o)c=cc(c1(=c([o-])c(=o)c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Polyrenyl-benzene-1-2-diols 3-Polyrenyl-benzene-1-2-diols] == * common-name: ** a 3-(all-tran...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-90 CPD1F-90] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Polyrenyl-benzene-1-2-diols 3-Polyrenyl-benzene-1-2-diols] ==
 
* common-name:
 
* common-name:
** kaempferol
+
** a 3-(all-trans-polyrenyl)benzene-1,2-diol
* smiles:
 
** c3(c=c(o)c=cc(c1(=c([o-])c(=o)c2(c(o)=cc(o)=cc(o1)=2)))=3)
 
* inchi-key:
 
** iyrmwmyzsqpjkc-uhfffaoysa-m
 
* molecular-weight:
 
** 285.232
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12510]]
+
* [[RXN-12160]]
* [[RXN-13935]]
 
* [[RXN1F-461]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN1F-93]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=kaempferol}}
+
{{#set: common-name=a 3-(all-trans-polyrenyl)benzene-1,2-diol}}
{{#set: inchi-key=inchikey=iyrmwmyzsqpjkc-uhfffaoysa-m}}
 
{{#set: molecular-weight=285.232}}
 

Revision as of 09:24, 27 August 2019

Metabolite 3-Polyrenyl-benzene-1-2-diols

  • common-name:
    • a 3-(all-trans-polyrenyl)benzene-1,2-diol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality