Difference between revisions of "SJ07205"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCTP DCTP] == * common-name: ** dctp * smiles: ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(op(...")
(Created page with "Category:gene == Gene SJ07205 == * transcription-direction: ** negative * right-end-position: ** 714748 * left-end-position: ** 714305 * centisome-position: ** 48.88897...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCTP DCTP] ==
+
== Gene SJ07205 ==
* common-name:
+
* transcription-direction:
** dctp
+
** negative
* smiles:
+
* right-end-position:
** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o
+
** 714748
* inchi-key:
+
* left-end-position:
** rgwhqcvhvjxokc-shyzeuofsa-j
+
** 714305
* molecular-weight:
+
* centisome-position:
** 463.127
+
** 48.88897   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[DCTCP]]
+
* [[S.japonica_carotenoid_curated]]
* [[DCTP-PYROPHOSPHATASE-RXN]]
+
== Reaction(s) associated ==
* [[DCTPtm]]
+
* [[RXN1F-20]]
* [[DCTUP]]
+
** Category: [[annotation]]
* [[RXN-14198]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-14216]]
+
== Pathway(s) associated ==
== Reaction(s) known to produce the compound ==
+
* [[PWY-5531]]
* [[ATDCD]]
+
** '''4''' reactions found over '''9''' reactions in the full pathway
* [[ATDCDm]]
+
* [[CHLOROPHYLL-SYN]]
* [[DCDPKIN-RXN]]
+
** '''6''' reactions found over '''9''' reactions in the full pathway
* [[DCTPtm]]
+
* [[PWY-7159]]
* [[RXN0-723]]
+
** '''5''' reactions found over '''9''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
{{#set: transcription-direction=negative}}
{{#set: common-name=dctp}}
+
{{#set: right-end-position=714748}}
{{#set: inchi-key=inchikey=rgwhqcvhvjxokc-shyzeuofsa-j}}
+
{{#set: left-end-position=714305}}
{{#set: molecular-weight=463.127}}
+
{{#set: centisome-position=48.88897    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=3}}

Latest revision as of 11:03, 18 March 2021

Gene SJ07205

  • transcription-direction:
    • negative
  • right-end-position:
    • 714748
  • left-end-position:
    • 714305
  • centisome-position:
    • 48.88897

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-5531
    • 4 reactions found over 9 reactions in the full pathway
  • CHLOROPHYLL-SYN
    • 6 reactions found over 9 reactions in the full pathway
  • PWY-7159
    • 5 reactions found over 9 reactions in the full pathway