Difference between revisions of "SJ07205"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=G5-pppR-mRNAs G5-pppR-mRNAs] == * common-name: ** a 5'-(5'-triphosphoguanosine)-purine-[mrna] =...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCTP DCTP] == * common-name: ** dctp * smiles: ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(op(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCTP DCTP] == |
* common-name: | * common-name: | ||
− | ** | + | ** dctp |
+ | * smiles: | ||
+ | ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o | ||
+ | * inchi-key: | ||
+ | ** rgwhqcvhvjxokc-shyzeuofsa-j | ||
+ | * molecular-weight: | ||
+ | ** 463.127 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[DCTCP]] |
+ | * [[DCTP-PYROPHOSPHATASE-RXN]] | ||
+ | * [[DCTPtm]] | ||
+ | * [[DCTUP]] | ||
+ | * [[RXN-14198]] | ||
+ | * [[RXN-14216]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[ATDCD]] |
+ | * [[ATDCDm]] | ||
+ | * [[DCDPKIN-RXN]] | ||
+ | * [[DCTPtm]] | ||
+ | * [[RXN0-723]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=dctp}} |
+ | {{#set: inchi-key=inchikey=rgwhqcvhvjxokc-shyzeuofsa-j}} | ||
+ | {{#set: molecular-weight=463.127}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite DCTP
- common-name:
- dctp
- smiles:
- c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o
- inchi-key:
- rgwhqcvhvjxokc-shyzeuofsa-j
- molecular-weight:
- 463.127