Difference between revisions of "SJ07205"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=G5-pppR-mRNAs G5-pppR-mRNAs] == * common-name: ** a 5'-(5'-triphosphoguanosine)-purine-[mrna] =...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCTP DCTP] == * common-name: ** dctp * smiles: ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(op(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=G5-pppR-mRNAs G5-pppR-mRNAs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCTP DCTP] ==
 
* common-name:
 
* common-name:
** a 5'-(5'-triphosphoguanosine)-purine-[mrna]
+
** dctp
 +
* smiles:
 +
** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o
 +
* inchi-key:
 +
** rgwhqcvhvjxokc-shyzeuofsa-j
 +
* molecular-weight:
 +
** 463.127
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[MRNA-GUANINE-N7--METHYLTRANSFERASE-RXN]]
+
* [[DCTCP]]
 +
* [[DCTP-PYROPHOSPHATASE-RXN]]
 +
* [[DCTPtm]]
 +
* [[DCTUP]]
 +
* [[RXN-14198]]
 +
* [[RXN-14216]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[MRNA-GUANYLYLTRANSFERASE-RXN]]
+
* [[ATDCD]]
 +
* [[ATDCDm]]
 +
* [[DCDPKIN-RXN]]
 +
* [[DCTPtm]]
 +
* [[RXN0-723]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 5'-(5'-triphosphoguanosine)-purine-[mrna]}}
+
{{#set: common-name=dctp}}
 +
{{#set: inchi-key=inchikey=rgwhqcvhvjxokc-shyzeuofsa-j}}
 +
{{#set: molecular-weight=463.127}}

Revision as of 14:20, 26 August 2019

Metabolite DCTP

  • common-name:
    • dctp
  • smiles:
    • c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o
  • inchi-key:
    • rgwhqcvhvjxokc-shyzeuofsa-j
  • molecular-weight:
    • 463.127

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality