Difference between revisions of "SJ07233"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE_PYRUVATE INDOLE_PYRUVATE] == * common-name: ** (indol-3-yl)pyruvate * smiles: ** c([o-])...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-ASP-tRNAs Charged-ASP-tRNAs] == * common-name: ** an l-aspartyl-[trnaasp] == Reaction(s...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE_PYRUVATE INDOLE_PYRUVATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-ASP-tRNAs Charged-ASP-tRNAs] ==
 
* common-name:
 
* common-name:
** (indol-3-yl)pyruvate
+
** an l-aspartyl-[trnaasp]
* smiles:
 
** c([o-])(=o)c(=o)cc1(=cnc2(c=cc=cc1=2))
 
* inchi-key:
 
** rstklpzezygqpy-uhfffaoysa-m
 
* molecular-weight:
 
** 202.189
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXNDQC-2]]
 
* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
+
* [[ASPARTATE--TRNA-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(indol-3-yl)pyruvate}}
+
{{#set: common-name=an l-aspartyl-[trnaasp]}}
{{#set: inchi-key=inchikey=rstklpzezygqpy-uhfffaoysa-m}}
 
{{#set: molecular-weight=202.189}}
 

Revision as of 14:20, 26 August 2019

Metabolite Charged-ASP-tRNAs

  • common-name:
    • an l-aspartyl-[trnaasp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an l-aspartyl-[trnaasp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.