Difference between revisions of "SJ07328"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE THIAMINE] == * common-name: ** thiamine * smiles: ** cc1([n+](=csc(cco)=1)cc2(c=nc(c)=...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16491 CPD-16491] == * common-name: ** 2,6-diamino-4-hydroxy-5-(n-methyl)formamidopyrimidine...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE THIAMINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16491 CPD-16491] ==
 
* common-name:
 
* common-name:
** thiamine
+
** 2,6-diamino-4-hydroxy-5-(n-methyl)formamidopyrimidine
 
* smiles:
 
* smiles:
** cc1([n+](=csc(cco)=1)cc2(c=nc(c)=nc(n)=2))
+
** cn([ch]=o)c1(c(o)=nc(n)=nc(n)=1)
 
* inchi-key:
 
* inchi-key:
** jzrwcgzrtzmzeh-uhfffaoysa-n
+
** cgwdnafnqobsck-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 265.352
+
** 183.169
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ExchangeSeed-THIAMINE]]
 
* [[THIAMIN-PYROPHOSPHOKINASE-RXN]]
 
* [[THIAMINASE-RXN]]
 
* [[TransportSeed-THIAMINE]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ExchangeSeed-THIAMINE]]
+
* [[3.2.2.23-RXN]]
* [[TransportSeed-THIAMINE]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=thiamine}}
+
{{#set: common-name=2,6-diamino-4-hydroxy-5-(n-methyl)formamidopyrimidine}}
{{#set: inchi-key=inchikey=jzrwcgzrtzmzeh-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=cgwdnafnqobsck-uhfffaoysa-n}}
{{#set: molecular-weight=265.352}}
+
{{#set: molecular-weight=183.169}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-16491

  • common-name:
    • 2,6-diamino-4-hydroxy-5-(n-methyl)formamidopyrimidine
  • smiles:
    • cn([ch]=o)c1(c(o)=nc(n)=nc(n)=1)
  • inchi-key:
    • cgwdnafnqobsck-uhfffaoysa-n
  • molecular-weight:
    • 183.169

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality