Difference between revisions of "SJ07344"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17275 CPD-17275] == * common-name: ** 7-oxolithocholate * smiles: ** cc([ch]3(cc[ch]4([ch]2...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9866 CPD-9866] == * common-name: ** 2-methoxy-6-(all-trans-nonaprenyl)phenol * smiles: ** c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17275 CPD-17275] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9866 CPD-9866] ==
 
* common-name:
 
* common-name:
** 7-oxolithocholate
+
** 2-methoxy-6-(all-trans-nonaprenyl)phenol
 
* smiles:
 
* smiles:
** cc([ch]3(cc[ch]4([ch]2(c(=o)c[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34)))))ccc(=o)[o-]
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** dxocdbgwdzayrq-aurdafmxsa-m
+
** xryxraoxvpwhhk-ssrazkmssa-n
 
* molecular-weight:
 
* molecular-weight:
** 389.554
+
** 737.203
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16033]]
+
* [[RXN-9240]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=7-oxolithocholate}}
+
{{#set: common-name=2-methoxy-6-(all-trans-nonaprenyl)phenol}}
{{#set: inchi-key=inchikey=dxocdbgwdzayrq-aurdafmxsa-m}}
+
{{#set: inchi-key=inchikey=xryxraoxvpwhhk-ssrazkmssa-n}}
{{#set: molecular-weight=389.554}}
+
{{#set: molecular-weight=737.203}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-9866

  • common-name:
    • 2-methoxy-6-(all-trans-nonaprenyl)phenol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c)c)c)c
  • inchi-key:
    • xryxraoxvpwhhk-ssrazkmssa-n
  • molecular-weight:
    • 737.203

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality