Difference between revisions of "SJ07367"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-367 CPD-367] == * common-name: ** (2r)-3-sulfolactate * smiles: ** c(=o)([o-])c(o)cs([o-])(...")
(Created page with "Category:gene == Gene SJ07367 == * transcription-direction: ** negative * right-end-position: ** 63757 * left-end-position: ** 55547 * centisome-position: ** 80.79799...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-367 CPD-367] ==
+
== Gene SJ07367 ==
* common-name:
+
* transcription-direction:
** (2r)-3-sulfolactate
+
** negative
* smiles:
+
* right-end-position:
** c(=o)([o-])c(o)cs([o-])(=o)=o
+
** 63757
* inchi-key:
+
* left-end-position:
** cqqgiwjsicouon-reohclbhsa-l
+
** 55547
* molecular-weight:
+
* centisome-position:
** 168.121
+
** 80.79799   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[R230-RXN]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[R230-RXN]]
+
* [[RIBOKIN-RXN]]
* [[RXN-11727]]
+
** Category: [[annotation]]
== Reaction(s) of unknown directionality ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: common-name=(2r)-3-sulfolactate}}
+
** Category: [[orthology]]
{{#set: inchi-key=inchikey=cqqgiwjsicouon-reohclbhsa-l}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
{{#set: molecular-weight=168.121}}
+
* [[RXN-14223]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[RIBOKIN-PWY]]
 +
** '''1''' reactions found over '''2''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=63757}}
 +
{{#set: left-end-position=55547}}
 +
{{#set: centisome-position=80.79799    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:03, 18 March 2021

Gene SJ07367

  • transcription-direction:
    • negative
  • right-end-position:
    • 63757
  • left-end-position:
    • 55547
  • centisome-position:
    • 80.79799

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • RIBOKIN-PWY
    • 1 reactions found over 2 reactions in the full pathway