Difference between revisions of "SJ07378"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-Cysteine-Desulfurases L-Cysteine-Desulfurases] == * common-name: ** an [l-cysteine desulfuras...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-RIBULOSE-15-P2 D-RIBULOSE-15-P2] == * common-name: ** d-ribulose-1,5-bisphosphate * smiles: *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-Cysteine-Desulfurases L-Cysteine-Desulfurases] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-RIBULOSE-15-P2 D-RIBULOSE-15-P2] ==
 
* common-name:
 
* common-name:
** an [l-cysteine desulfurase]
+
** d-ribulose-1,5-bisphosphate
 +
* smiles:
 +
** c(op([o-])([o-])=o)c(o)c(o)c(=o)cop(=o)([o-])[o-]
 +
* inchi-key:
 +
** yahzabjorduqgo-nqxxgfsbsa-j
 +
* molecular-weight:
 +
** 306.059
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15881]]
+
* [[PHOSPHORIBULOKINASE-RXN]]
 +
* [[RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[PHOSPHORIBULOKINASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an [l-cysteine desulfurase]}}
+
{{#set: common-name=d-ribulose-1,5-bisphosphate}}
 +
{{#set: inchi-key=inchikey=yahzabjorduqgo-nqxxgfsbsa-j}}
 +
{{#set: molecular-weight=306.059}}

Revision as of 09:24, 27 August 2019

Metabolite D-RIBULOSE-15-P2

  • common-name:
    • d-ribulose-1,5-bisphosphate
  • smiles:
    • c(op([o-])([o-])=o)c(o)c(o)c(=o)cop(=o)([o-])[o-]
  • inchi-key:
    • yahzabjorduqgo-nqxxgfsbsa-j
  • molecular-weight:
    • 306.059

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality