Difference between revisions of "SJ07437"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18490 CPD-18490] == * common-name: ** (2e,9z,12z,15z,18z)-tetracosa-2,9,12,15,18-pentaenoyl...")
(Created page with "Category:gene == Gene SJ14159 == * transcription-direction: ** negative * right-end-position: ** 343100 * left-end-position: ** 332433 * centisome-position: ** 46.270283...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18490 CPD-18490] ==
+
== Gene SJ14159 ==
* common-name:
+
* transcription-direction:
** (2e,9z,12z,15z,18z)-tetracosa-2,9,12,15,18-pentaenoyl-coa
+
** negative
* smiles:
+
* right-end-position:
** cccccc=ccc=ccc=ccc=ccccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** 343100
* inchi-key:
+
* left-end-position:
** avrcofdawhwkmb-mnthwfihsa-j
+
** 332433
* molecular-weight:
+
* centisome-position:
** 1104.05
+
** 46.270283   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_sterols_curated]]
* [[RXN-17110]]
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[HISTONE-ACETYLTRANSFERASE-RXN]]
{{#set: common-name=(2e,9z,12z,15z,18z)-tetracosa-2,9,12,15,18-pentaenoyl-coa}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=avrcofdawhwkmb-mnthwfihsa-j}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=1104.05}}
+
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=343100}}
 +
{{#set: left-end-position=332433}}
 +
{{#set: centisome-position=46.270283    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=1}}

Revision as of 20:19, 18 December 2020

Gene SJ14159

  • transcription-direction:
    • negative
  • right-end-position:
    • 343100
  • left-end-position:
    • 332433
  • centisome-position:
    • 46.270283

Organism(s) associated with this gene

Reaction(s) associated