Difference between revisions of "SJ07451"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-181 CPD-181] == * common-name: ** 4-methylumbelliferyl acetate * smiles: ** cc2(=cc(oc1(=c(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Glutamine-synthetase-adenylyl-Tyr Glutamine-synthetase-adenylyl-Tyr] == * common-name: ** a [gl...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-181 CPD-181] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Glutamine-synthetase-adenylyl-Tyr Glutamine-synthetase-adenylyl-Tyr] ==
 
* common-name:
 
* common-name:
** 4-methylumbelliferyl acetate
+
** a [glutamine synthetase]-o4-(5'-adenylyl)-l-tyrosine
* smiles:
 
** cc2(=cc(oc1(=c(c=cc(oc(=o)c)=c1)2))=o)
 
* inchi-key:
 
** hxvzgascdagaps-uhfffaoysa-n
 
* molecular-weight:
 
** 218.209
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.1.1.56-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[GSADENYLATION-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-methylumbelliferyl acetate}}
+
{{#set: common-name=a [glutamine synthetase]-o4-(5'-adenylyl)-l-tyrosine}}
{{#set: inchi-key=inchikey=hxvzgascdagaps-uhfffaoysa-n}}
 
{{#set: molecular-weight=218.209}}
 

Revision as of 09:23, 27 August 2019

Metabolite Glutamine-synthetase-adenylyl-Tyr

  • common-name:
    • a [glutamine synthetase]-o4-(5'-adenylyl)-l-tyrosine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [glutamine synthetase]-o4-(5'-adenylyl)-l-tyrosine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.