Difference between revisions of "SJ07454"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14875 CPD-14875] == * common-name: ** grixazone b * smiles: ** cc(=o)nc(c([o-])=o)csc1(=c(n...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9007 CPD-9007] == * common-name: ** adp ribose 1'',2''-cyclic phosphate * smiles: ** c(c3(c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14875 CPD-14875] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9007 CPD-9007] ==
 
* common-name:
 
* common-name:
** grixazone b
+
** adp ribose 1'',2''-cyclic phosphate
 
* smiles:
 
* smiles:
** cc(=o)nc(c([o-])=o)csc1(=c(n)c(=o)c=c2(c1=nc3(c(o2)=cc=c(c([o-])=o)c=3)))
+
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op(=o)([o-])occ5(c(o)c4(c(op([o-])(=o)o4)o5)))([o-])=o
 
* inchi-key:
 
* inchi-key:
** kupqduioulxtjz-jtqlqieisa-l
+
** npspryxpogpcpm-tyasjmozsa-k
 
* molecular-weight:
 
* molecular-weight:
** 415.377
+
** 618.26
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15414]]
+
* [[2.7.1.160-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=grixazone b}}
+
{{#set: common-name=adp ribose 1'',2''-cyclic phosphate}}
{{#set: inchi-key=inchikey=kupqduioulxtjz-jtqlqieisa-l}}
+
{{#set: inchi-key=inchikey=npspryxpogpcpm-tyasjmozsa-k}}
{{#set: molecular-weight=415.377}}
+
{{#set: molecular-weight=618.26}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-9007

  • common-name:
    • adp ribose 1,2-cyclic phosphate
  • smiles:
    • c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op(=o)([o-])occ5(c(o)c4(c(op([o-])(=o)o4)o5)))([o-])=o
  • inchi-key:
    • npspryxpogpcpm-tyasjmozsa-k
  • molecular-weight:
    • 618.26

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality