Difference between revisions of "SJ07488"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPOYL-COA SINAPOYL-COA] == * common-name: ** sinapoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-28 CPD66-28] == * common-name: ** pregn-5-ene-3,20-dione * smiles: ** cc(=o)[ch]3(cc[ch]4...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPOYL-COA SINAPOYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-28 CPD66-28] ==
 
* common-name:
 
* common-name:
** sinapoyl-coa
+
** pregn-5-ene-3,20-dione
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=c(oc)c=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+
** cc(=o)[ch]3(cc[ch]4([ch]2(cc=c1(cc(=o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** rbfuwesmwrugfy-gsnioflcsa-j
+
** mnrhzpcieglwgk-lekssakusa-n
 
* molecular-weight:
 
* molecular-weight:
** 969.7
+
** 314.467
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-1124]]
+
* [[RXN66-353]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10919]]
+
* [[RXN66-353]]
* [[RXN-1124]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=sinapoyl-coa}}
+
{{#set: common-name=pregn-5-ene-3,20-dione}}
{{#set: inchi-key=inchikey=rbfuwesmwrugfy-gsnioflcsa-j}}
+
{{#set: inchi-key=inchikey=mnrhzpcieglwgk-lekssakusa-n}}
{{#set: molecular-weight=969.7}}
+
{{#set: molecular-weight=314.467}}

Revision as of 14:19, 26 August 2019

Metabolite CPD66-28

  • common-name:
    • pregn-5-ene-3,20-dione
  • smiles:
    • cc(=o)[ch]3(cc[ch]4([ch]2(cc=c1(cc(=o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • mnrhzpcieglwgk-lekssakusa-n
  • molecular-weight:
    • 314.467

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality