Difference between revisions of "SJ07583"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4441 CPD-4441] == * common-name: ** cis-zeatin * smiles: ** cc(co)=ccnc2(c1(=c(nc=n1)n=cn=2...")
(Created page with "Category:gene == Gene SJ07583 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * PROTEIN-KINASE-RXN **...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4441 CPD-4441] ==
+
== Gene SJ07583 ==
* common-name:
+
== Organism(s) associated with this gene  ==
** cis-zeatin
+
* [[S.japonica_carotenoid_curated]]
* smiles:
+
== Reaction(s) associated ==
** cc(co)=ccnc2(c1(=c(nc=n1)n=cn=2))
+
* [[PROTEIN-KINASE-RXN]]
* inchi-key:
+
** Category: [[orthology]]
** uzkqtcbamswpjd-uqcoibpssa-n
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* molecular-weight:
+
* [[RXN-8443]]
** 219.246
+
** Category: [[orthology]]
== Reaction(s) known to consume the compound ==
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* [[RXN-4733]]
+
== Pathway(s) associated ==
== Reaction(s) known to produce the compound ==
+
* [[PWY-5381]]
== Reaction(s) of unknown directionality ==
+
** '''6''' reactions found over '''11''' reactions in the full pathway
{{#set: common-name=cis-zeatin}}
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
{{#set: inchi-key=inchikey=uzkqtcbamswpjd-uqcoibpssa-n}}
+
{{#set: nb reaction associated=2}}
{{#set: molecular-weight=219.246}}
+
{{#set: nb pathway associated=1}}

Latest revision as of 11:03, 18 March 2021

Gene SJ07583

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-5381
    • 6 reactions found over 11 reactions in the full pathway