Difference between revisions of "SJ07583"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAMMA-BUTYROBETAINE GAMMA-BUTYROBETAINE] == * common-name: ** γ-butyrobetaine * smiles: *...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4441 CPD-4441] == * common-name: ** cis-zeatin * smiles: ** cc(co)=ccnc2(c1(=c(nc=n1)n=cn=2...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4441 CPD-4441] == |
* common-name: | * common-name: | ||
| − | ** | + | ** cis-zeatin |
* smiles: | * smiles: | ||
| − | ** c | + | ** cc(co)=ccnc2(c1(=c(nc=n1)n=cn=2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** uzkqtcbamswpjd-uqcoibpssa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 219.246 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-4733]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=cis-zeatin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=uzkqtcbamswpjd-uqcoibpssa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=219.246}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-4441
- common-name:
- cis-zeatin
- smiles:
- cc(co)=ccnc2(c1(=c(nc=n1)n=cn=2))
- inchi-key:
- uzkqtcbamswpjd-uqcoibpssa-n
- molecular-weight:
- 219.246
