Difference between revisions of "SJ07592"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ20458 == * transcription-direction: ** positive * right-end-position: ** 1048083 * left-end-position: ** 1013084 * centisome-position: ** 89.20246...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17894 CPD-17894] == * common-name: ** β-d-mannosyl-(c55 ω-saturated dolichyl pho...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ20458 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17894 CPD-17894] ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** β-d-mannosyl-(c55 ω-saturated dolichyl phosphate)
−
* right-end-position:
+
* smiles:
−
** 1048083
+
** cc(c)cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(ccop(=o)([o-])oc1(oc(co)c(o)c(o)c(o)1))c
−
* left-end-position:
+
* inchi-key:
−
** 1013084
+
** mbyvktiiznuhkn-nivaaieqsa-m
−
* centisome-position:
+
* molecular-weight:
−
** 89.20246   
+
** 1012.461
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN-16602]]
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) of unknown directionality ==
−
* [[3.6.3.44-RXN]]
+
{{#set: common-name=&beta;-d-mannosyl-(c55 &omega;-saturated dolichyl phosphate)}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=mbyvktiiznuhkn-nivaaieqsa-m}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=1012.461}}
−
* [[ATPASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12195]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12196]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN0-5462]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[TRANS-RXN-311]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7210]]
 
−
** '''8''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-7198]]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-7184]]
 
−
** '''9''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-6545]]
 
−
** '''8''' reactions found over '''9''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=1048083}}
 
−
{{#set: left-end-position=1013084}}
 
−
{{#set: centisome-position=89.20246    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=7}}
 
−
{{#set: nb pathway associated=4}}
 

Revision as of 09:25, 27 August 2019

Metabolite CPD-17894

  • common-name:
    • β-d-mannosyl-(c55 ω-saturated dolichyl phosphate)
  • smiles:
    • cc(c)cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(ccop(=o)([o-])oc1(oc(co)c(o)c(o)c(o)1))c
  • inchi-key:
    • mbyvktiiznuhkn-nivaaieqsa-m
  • molecular-weight:
    • 1012.461

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ07592&oldid=29167"