Difference between revisions of "SJ07608"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-505 CPD-505] == * common-name: ** d-myo-inositol (1,3,4,6)-tetrakisphosphate * smiles: ** c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8978 CPD-8978] == * common-name: ** ethylphosphate * smiles: ** ccop([o-])(=o)[o-] * inchi-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-505 CPD-505] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8978 CPD-8978] ==
 
* common-name:
 
* common-name:
** d-myo-inositol (1,3,4,6)-tetrakisphosphate
+
** ethylphosphate
 
* smiles:
 
* smiles:
** c1(o)(c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
+
** ccop([o-])(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** zawixngttztbkv-jmvowjsssa-f
+
** zjxzsiysnxkhea-uhfffaoysa-l
 
* molecular-weight:
 
* molecular-weight:
** 492.013
+
** 124.033
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.1.140-RXN]]
+
* [[RXN-8748]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.1.133-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-myo-inositol (1,3,4,6)-tetrakisphosphate}}
+
{{#set: common-name=ethylphosphate}}
{{#set: inchi-key=inchikey=zawixngttztbkv-jmvowjsssa-f}}
+
{{#set: inchi-key=inchikey=zjxzsiysnxkhea-uhfffaoysa-l}}
{{#set: molecular-weight=492.013}}
+
{{#set: molecular-weight=124.033}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-8978

  • common-name:
    • ethylphosphate
  • smiles:
    • ccop([o-])(=o)[o-]
  • inchi-key:
    • zjxzsiysnxkhea-uhfffaoysa-l
  • molecular-weight:
    • 124.033

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality