Difference between revisions of "SJ07630"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-PRO-tRNAs Charged-PRO-tRNAs] == * common-name: ** an l-prolyl-[trnapro] == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNOSE-1P MANNOSE-1P] == * common-name: ** α-d-mannose 1-phosphate * smiles: ** c(o)c1(o...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNOSE-1P MANNOSE-1P] == |
* common-name: | * common-name: | ||
− | ** | + | ** α-d-mannose 1-phosphate |
+ | * smiles: | ||
+ | ** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) | ||
+ | * inchi-key: | ||
+ | ** hxxfsfrbohsimq-rwopyejcsa-l | ||
+ | * molecular-weight: | ||
+ | ** 258.121 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[MANNPGUANYLTRANGDP-RXN]] | ||
+ | * [[PHOSMANMUT-RXN]] | ||
+ | * [[PHOSMANMUT-RXN-MANNOSE-1P//MANNOSE-6P.23.]] | ||
+ | * [[RXN4FS-12]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[MANNPGUANYLTRANGDP-RXN]] |
+ | * [[PHOSMANMUT-RXN]] | ||
+ | * [[PHOSMANMUT-RXN-MANNOSE-1P//MANNOSE-6P.23.]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=α-d-mannose 1-phosphate}} |
+ | {{#set: inchi-key=inchikey=hxxfsfrbohsimq-rwopyejcsa-l}} | ||
+ | {{#set: molecular-weight=258.121}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite MANNOSE-1P
- common-name:
- α-d-mannose 1-phosphate
- smiles:
- c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
- inchi-key:
- hxxfsfrbohsimq-rwopyejcsa-l
- molecular-weight:
- 258.121