Difference between revisions of "SJ07645"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-37 CPDQT-37] == * common-name: ** 3-[(4'-methylthio)butyl]malate * smiles: ** csccccc(c(o...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-452 CPD-452] == * common-name: ** a 6-(n-acetyl-α-d-glucosaminyl)-1-phosphatidyl-1d-m...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-37 CPDQT-37] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-452 CPD-452] ==
 
* common-name:
 
* common-name:
** 3-[(4'-methylthio)butyl]malate
+
** a 6-(n-acetyl-α-d-glucosaminyl)-1-phosphatidyl-1d-myo-inositol
* smiles:
 
** csccccc(c(o)c(=o)[o-])c(=o)[o-]
 
* inchi-key:
 
** zizldvklmyvmnx-uhfffaoysa-l
 
* molecular-weight:
 
** 234.267
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-18206]]
+
* [[2.4.1.198-RXN]]
* [[RXNQT-4168]]
+
* [[3.1.1.69-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-18206]]
+
* [[2.4.1.198-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-[(4'-methylthio)butyl]malate}}
+
{{#set: common-name=a 6-(n-acetyl-α-d-glucosaminyl)-1-phosphatidyl-1d-myo-inositol}}
{{#set: inchi-key=inchikey=zizldvklmyvmnx-uhfffaoysa-l}}
 
{{#set: molecular-weight=234.267}}
 

Revision as of 09:24, 27 August 2019

Metabolite CPD-452

  • common-name:
    • a 6-(n-acetyl-α-d-glucosaminyl)-1-phosphatidyl-1d-myo-inositol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality