Difference between revisions of "SJ07700"

Revision as of 09:24, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-L-KYNURENINE 3-HYDROXY-L-KYNURENINE] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENINE ADENINE] ==
 * common-name:
-** 3-hydroxy-l-kynurenine
+** adenine
 * smiles:
-** c([o-])(=o)c([n+])cc(=o)c1(=c(n)c(o)=cc=c1)
+** c1(n)(n=cn=c2(nc=nc=12))
 * inchi-key:
-** vckpuufaignjhc-lurjtmiesa-n
+** gffgjbxgbjisgv-uhfffaoysa-n
 * molecular-weight:
-** 224.216
+** 135.128
 == Reaction(s) known to consume the compound ==
-* [[RXN-10721]]
+* [[1.5.99.12-RXN]]
+* [[ADENPHOSPHOR-RXN]]
+* [[ADENPRIBOSYLTRAN-RXN]]
+* [[APPRT]]
+* [[DEOXYADENPHOSPHOR-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[KYNURENINE-3-MONOOXYGENASE-RXN]]
+* [[1.5.99.12-RXN]]
-* [[RXN-10721]]
+* [[ADENOSYLHOMOCYSTEINE-NUCLEOSIDASE-RXN]]
+* [[ADENPHOSPHOR-RXN]]
+* [[APPRT]]
+* [[DEOXYADENPHOSPHOR-RXN]]
+* [[M5TAP]]
+* [[METHYLTHIOADENOSINE-NUCLEOSIDASE-RXN]]
+* [[RXN-11715]]
+* [[RXN-11743]]
+* [[RXN0-984]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=3-hydroxy-l-kynurenine}}
+{{#set: common-name=adenine}}
-{{#set: inchi-key=inchikey=vckpuufaignjhc-lurjtmiesa-n}}
+{{#set: inchi-key=inchikey=gffgjbxgbjisgv-uhfffaoysa-n}}
-{{#set: molecular-weight=224.216}}
+{{#set: molecular-weight=135.128}}