Difference between revisions of "SJ07710"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14282 CPD-14282] == * common-name: ** trans-lignocer-2-enoyl-coa * smiles: ** ccccccccccccc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOXYL INDOXYL] == * common-name: ** indoxyl * smiles: ** c2(c=cc1(=c(c(o)=cn1)c=2)) * inchi-k...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14282 CPD-14282] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOXYL INDOXYL] ==
 
* common-name:
 
* common-name:
** trans-lignocer-2-enoyl-coa
+
** indoxyl
 
* smiles:
 
* smiles:
** cccccccccccccccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
+
** c2(c=cc1(=c(c(o)=cn1)c=2))
 
* inchi-key:
 
* inchi-key:
** uvjkzcsqlmwpmv-lqjawxtisa-j
+
** pckpvgolpkluhr-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 1112.113
+
** 133.149
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13308]]
+
* [[RXN-15587]]
* [[TRANS-2-ENOYL-COA-REDUCTASE-NAD+-RXN-CPD-10280/NAD//CPD-14282/NADH/PROTON.37.]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13304]]
+
* [[RXN-15587]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=trans-lignocer-2-enoyl-coa}}
+
{{#set: common-name=indoxyl}}
{{#set: inchi-key=inchikey=uvjkzcsqlmwpmv-lqjawxtisa-j}}
+
{{#set: inchi-key=inchikey=pckpvgolpkluhr-uhfffaoysa-n}}
{{#set: molecular-weight=1112.113}}
+
{{#set: molecular-weight=133.149}}

Revision as of 09:23, 27 August 2019

Metabolite INDOXYL

  • common-name:
    • indoxyl
  • smiles:
    • c2(c=cc1(=c(c(o)=cn1)c=2))
  • inchi-key:
    • pckpvgolpkluhr-uhfffaoysa-n
  • molecular-weight:
    • 133.149

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality