Difference between revisions of "SJ07710"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOXYL INDOXYL] == * common-name: ** indoxyl * smiles: ** c2(c=cc1(=c(c(o)=cn1)c=2)) * inchi-k...") |
(Created page with "Category:gene == Gene SJ07710 == * transcription-direction: ** positive * right-end-position: ** 12806 * left-end-position: ** 296 * centisome-position: ** 3.344901200e-2...") |
||
(7 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:gene]] |
− | == | + | == Gene SJ07710 == |
− | * | + | * transcription-direction: |
− | ** | + | ** positive |
− | * | + | * right-end-position: |
− | ** | + | ** 12806 |
− | * | + | * left-end-position: |
− | ** | + | ** 296 |
− | * | + | * centisome-position: |
− | ** | + | ** 3.344901200e-2 |
− | == | + | == Organism(s) associated with this gene == |
− | * [[ | + | * [[S.japonica_carotenoid_curated]] |
− | == Reaction(s) | + | == Reaction(s) associated == |
− | * [[RXN | + | * [[DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]] |
− | == | + | ** Category: [[annotation]] |
− | {{#set: | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
− | {{#set: | + | == Pathway(s) associated == |
− | {{#set: | + | * [[TRIGLSYN-PWY]] |
+ | ** '''5''' reactions found over '''7''' reactions in the full pathway | ||
+ | {{#set: transcription-direction=positive}} | ||
+ | {{#set: right-end-position=12806}} | ||
+ | {{#set: left-end-position=296}} | ||
+ | {{#set: centisome-position=3.344901200e-2}} | ||
+ | {{#set: organism associated=S.japonica_carotenoid_curated}} | ||
+ | {{#set: nb reaction associated=1}} | ||
+ | {{#set: nb pathway associated=1}} |
Latest revision as of 11:00, 18 March 2021
Contents
Gene SJ07710
- transcription-direction:
- positive
- right-end-position:
- 12806
- left-end-position:
- 296
- centisome-position:
- 3.344901200e-2
Organism(s) associated with this gene
Reaction(s) associated
- DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
Pathway(s) associated
- TRIGLSYN-PWY
- 5 reactions found over 7 reactions in the full pathway