Difference between revisions of "SJ07733"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-SERINE D-SERINE] == * common-name: ** d-serine * smiles: ** c(o)c([n+])c([o-])=o * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-67 CPD-67] == * common-name: ** 2-phosphoglycolate * smiles: ** c(op([o-])(=o)[o-])c([o-])=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-67 CPD-67] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-phosphoglycolate |
* smiles: | * smiles: | ||
| − | ** c(o) | + | ** c(op([o-])(=o)[o-])c([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ascfnmcahfubco-uhfffaoysa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 153.008 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[GPH-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-phosphoglycolate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ascfnmcahfubco-uhfffaoysa-k}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=153.008}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-67
- common-name:
- 2-phosphoglycolate
- smiles:
- c(op([o-])(=o)[o-])c([o-])=o
- inchi-key:
- ascfnmcahfubco-uhfffaoysa-k
- molecular-weight:
- 153.008
