Difference between revisions of "SJ07733"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-67 CPD-67] == * common-name: ** 2-phosphoglycolate * smiles: ** c(op([o-])(=o)[o-])c([o-])=...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13927 CPD-13927] == * common-name: ** (z)-2-methylureidoacrylate peracid * smiles: ** cc(=c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-67 CPD-67] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13927 CPD-13927] ==
 
* common-name:
 
* common-name:
** 2-phosphoglycolate
+
** (z)-2-methylureidoacrylate peracid
 
* smiles:
 
* smiles:
** c(op([o-])(=o)[o-])c([o-])=o
+
** cc(=cnc(n)=o)c(=o)oo
 
* inchi-key:
 
* inchi-key:
** ascfnmcahfubco-uhfffaoysa-k
+
** ghikatudzmbujc-ihwypqmzsa-n
 
* molecular-weight:
 
* molecular-weight:
** 153.008
+
** 160.129
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GPH-RXN]]
+
* [[RXN-12895]]
 +
* [[RXN-12896]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-phosphoglycolate}}
+
{{#set: common-name=(z)-2-methylureidoacrylate peracid}}
{{#set: inchi-key=inchikey=ascfnmcahfubco-uhfffaoysa-k}}
+
{{#set: inchi-key=inchikey=ghikatudzmbujc-ihwypqmzsa-n}}
{{#set: molecular-weight=153.008}}
+
{{#set: molecular-weight=160.129}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-13927

  • common-name:
    • (z)-2-methylureidoacrylate peracid
  • smiles:
    • cc(=cnc(n)=o)c(=o)oo
  • inchi-key:
    • ghikatudzmbujc-ihwypqmzsa-n
  • molecular-weight:
    • 160.129

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality