Difference between revisions of "SJ07759"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TYR TYR] == * common-name: ** l-tyrosine * smiles: ** c(c(cc1(c=cc(o)=cc=1))[n+])(=o)[o-] * inc...") |
(Created page with "Category:gene == Gene SJ16106 == * transcription-direction: ** positive * right-end-position: ** 244289 * left-end-position: ** 233953 * centisome-position: ** 81.25541...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:gene]] |
| − | == | + | == Gene SJ16106 == |
| − | * | + | * transcription-direction: |
| − | ** | + | ** positive |
| − | * | + | * right-end-position: |
| − | ** | + | ** 244289 |
| − | * | + | * left-end-position: |
| − | ** | + | ** 233953 |
| − | * | + | * centisome-position: |
| − | ** | + | ** 81.25541 |
| − | == | + | == Organism(s) associated with this gene == |
| − | * [[ | + | * [[S.japonica_sterols_curated]] |
| − | * [[ | + | == Reaction(s) associated == |
| − | * | + | * [[DNA-DIRECTED-DNA-POLYMERASE-RXN]] |
| − | * [[ | + | ** Category: [[annotation]] |
| − | * | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
| − | * | + | {{#set: transcription-direction=positive}} |
| − | * [[ | + | {{#set: right-end-position=244289}} |
| − | + | {{#set: left-end-position=233953}} | |
| − | = | + | {{#set: centisome-position=81.25541 }} |
| − | + | {{#set: organism associated=S.japonica_sterols_curated}} | |
| − | + | {{#set: nb reaction associated=1}} | |
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | {{#set: | ||
Revision as of 20:21, 18 December 2020
Gene SJ16106
- transcription-direction:
- positive
- right-end-position:
- 244289
- left-end-position:
- 233953
- centisome-position:
- 81.25541
Organism(s) associated with this gene
Reaction(s) associated
- DNA-DIRECTED-DNA-POLYMERASE-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
