Difference between revisions of "SJ07766"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 6E8Z11Z14Z-5S-5-HYDROPEROXYCOSA-6 == * common-name: ** (5s)-hpete * smiles: ** cccccc=ccc=ccc=cc=cc(oo)cccc([o-])=o * inchi-key: ** jnuun...") |
(Created page with "Category:gene == Gene SJ07766 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 3.4.21.53-RXN ** Categ...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:gene]] |
| − | == | + | == Gene SJ07766 == |
| − | + | == Organism(s) associated with this gene == | |
| − | + | * [[S.japonica_carotenoid_curated]] | |
| − | + | == Reaction(s) associated == | |
| − | + | * [[3.4.21.53-RXN]] | |
| − | + | ** Category: [[orthology]] | |
| − | + | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | + | {{#set: organism associated=S.japonica_carotenoid_curated}} | |
| − | + | {{#set: nb reaction associated=1}} | |
| − | |||
| − | * [[ | ||
| − | == Reaction(s) | ||
| − | * [[ | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
Latest revision as of 11:10, 18 March 2021
Gene SJ07766
Organism(s) associated with this gene
Reaction(s) associated
- 3.4.21.53-RXN
- Category: orthology
- source: output_pantograph_ectocarpus_siliculosus; tool: pantograph; comment: n.a
- Category: orthology
