Difference between revisions of "SJ07783"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15016 CPD-15016] == * common-name: ** (4s)-4-hydroxy-2-oxoglutarate * smiles: ** c(c(=o)c([...")
(Created page with "Category:gene == Gene SJ07783 == * transcription-direction: ** negative * right-end-position: ** 149627 * left-end-position: ** 146547 * centisome-position: ** 32.664864...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15016 CPD-15016] ==
+
== Gene SJ07783 ==
* common-name:
+
* transcription-direction:
** (4s)-4-hydroxy-2-oxoglutarate
+
** negative
* smiles:
+
* right-end-position:
** c(c(=o)c([o-])=o)c(c([o-])=o)o
+
** 149627
* inchi-key:
+
* left-end-position:
** wxskvkpsmahcsg-reohclbhsa-l
+
** 146547
* molecular-weight:
+
* centisome-position:
** 160.083
+
** 32.664864   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-13990]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[RXN-13990]]
+
* [[3.1.26.4-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=(4s)-4-hydroxy-2-oxoglutarate}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=wxskvkpsmahcsg-reohclbhsa-l}}
+
* [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
{{#set: molecular-weight=160.083}}
+
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=149627}}
 +
{{#set: left-end-position=146547}}
 +
{{#set: centisome-position=32.664864    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=3}}

Latest revision as of 11:00, 18 March 2021

Gene SJ07783

  • transcription-direction:
    • negative
  • right-end-position:
    • 149627
  • left-end-position:
    • 146547
  • centisome-position:
    • 32.664864

Organism(s) associated with this gene

Reaction(s) associated