Difference between revisions of "SJ07783"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11398 CPD-11398] == * common-name: ** l-thyroxine phenolic β-d-glucuronide * smiles: *...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8621 CPD-8621] == * common-name: ** zymostenol * smiles: ** cc(c)cccc([ch]4(c1(c)([ch](c2(=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11398 CPD-11398] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8621 CPD-8621] ==
 
* common-name:
 
* common-name:
** l-thyroxine phenolic β-d-glucuronide
+
** zymostenol
 
* smiles:
 
* smiles:
** c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=c1)oc3(c=c(i)c(oc2(oc(c(=o)[o-])c(o)c(o)c(o)2))=c(i)c=3))
+
** cc(c)cccc([ch]4(c1(c)([ch](c2(=c(cc1)c3(c)([ch](cc2)cc(o)cc3)))cc4)))c
 
* inchi-key:
 
* inchi-key:
** rghrjbikiyuhev-sgpdefqssa-m
+
** qetlkndkqoxzrp-xtgbijofsa-n
 
* molecular-weight:
 
* molecular-weight:
** 951.992
+
** 386.66
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10606]]
+
* [[RXN66-24]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-thyroxine phenolic β-d-glucuronide}}
+
{{#set: common-name=zymostenol}}
{{#set: inchi-key=inchikey=rghrjbikiyuhev-sgpdefqssa-m}}
+
{{#set: inchi-key=inchikey=qetlkndkqoxzrp-xtgbijofsa-n}}
{{#set: molecular-weight=951.992}}
+
{{#set: molecular-weight=386.66}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-8621

  • common-name:
    • zymostenol
  • smiles:
    • cc(c)cccc([ch]4(c1(c)([ch](c2(=c(cc1)c3(c)([ch](cc2)cc(o)cc3)))cc4)))c
  • inchi-key:
    • qetlkndkqoxzrp-xtgbijofsa-n
  • molecular-weight:
    • 386.66

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality