Difference between revisions of "SJ07783"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11398 CPD-11398] == * common-name: ** l-thyroxine phenolic β-d-glucuronide * smiles: *...")
 
(Created page with "Category:gene == Gene SJ07783 == * transcription-direction: ** negative * right-end-position: ** 149627 * left-end-position: ** 146547 * centisome-position: ** 32.664864...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11398 CPD-11398] ==
+
== Gene SJ07783 ==
−
* common-name:
+
* transcription-direction:
−
** l-thyroxine phenolic β-d-glucuronide
+
** negative
−
* smiles:
+
* right-end-position:
−
** c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=c1)oc3(c=c(i)c(oc2(oc(c(=o)[o-])c(o)c(o)c(o)2))=c(i)c=3))
+
** 149627
−
* inchi-key:
+
* left-end-position:
−
** rghrjbikiyuhev-sgpdefqssa-m
+
** 146547
−
* molecular-weight:
+
* centisome-position:
−
** 951.992
+
** 32.664864   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_carotenoid_curated]]
−
* [[RXN-10606]]
+
== Reaction(s) associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[3.1.26.4-RXN]]
−
{{#set: common-name=l-thyroxine phenolic β-d-glucuronide}}
+
** Category: [[annotation]]
−
{{#set: inchi-key=inchikey=rghrjbikiyuhev-sgpdefqssa-m}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: molecular-weight=951.992}}
+
* [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=149627}}
 +
{{#set: left-end-position=146547}}
 +
{{#set: centisome-position=32.664864    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=3}}

Latest revision as of 11:00, 18 March 2021

Gene SJ07783

  • transcription-direction:
    • negative
  • right-end-position:
    • 149627
  • left-end-position:
    • 146547
  • centisome-position:
    • 32.664864

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ07783&oldid=131634"