Difference between revisions of "SJ07846"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3617 CPD-3617] == * common-name: ** decanoate * smiles: ** cccccccccc(=o)[o-] * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-AMINO-BENZOATE P-AMINO-BENZOATE] == * common-name: ** 4-aminobenzoate * smiles: ** c(=o)([o-]...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-AMINO-BENZOATE P-AMINO-BENZOATE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-aminobenzoate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(=o)([o-])c1(c=cc(=cc=1)n) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** alynczndiqevrv-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 136.13 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[ADCLY-RXN]] |
| + | * [[H2PTEROATESYNTH-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ADCLY-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-aminobenzoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=alynczndiqevrv-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=136.13}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite P-AMINO-BENZOATE
- common-name:
- 4-aminobenzoate
- smiles:
- c(=o)([o-])c1(c=cc(=cc=1)n)
- inchi-key:
- alynczndiqevrv-uhfffaoysa-m
- molecular-weight:
- 136.13
