Difference between revisions of "SJ07846"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-AMINO-BENZOATE P-AMINO-BENZOATE] == * common-name: ** 4-aminobenzoate * smiles: ** c(=o)([o-]...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-hydroxy-cis-D9-hexaecenoyl-ACPs 3-hydroxy-cis-D9-hexaecenoyl-ACPs] == * common-name: ** a (3r...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-AMINO-BENZOATE P-AMINO-BENZOATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-hydroxy-cis-D9-hexaecenoyl-ACPs 3-hydroxy-cis-D9-hexaecenoyl-ACPs] ==
 
* common-name:
 
* common-name:
** 4-aminobenzoate
+
** a (3r)-3-hydroxy cis δ9-hexadecenoyl-[acp]
* smiles:
 
** c(=o)([o-])c1(c=cc(=cc=1)n)
 
* inchi-key:
 
** alynczndiqevrv-uhfffaoysa-m
 
* molecular-weight:
 
** 136.13
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ADCLY-RXN]]
+
* [[RXN-10660]]
* [[H2PTEROATESYNTH-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ADCLY-RXN]]
+
* [[RXN-10659]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-aminobenzoate}}
+
{{#set: common-name=a (3r)-3-hydroxy cis δ9-hexadecenoyl-[acp]}}
{{#set: inchi-key=inchikey=alynczndiqevrv-uhfffaoysa-m}}
 
{{#set: molecular-weight=136.13}}
 

Revision as of 09:24, 27 August 2019

Metabolite 3-hydroxy-cis-D9-hexaecenoyl-ACPs

  • common-name:
    • a (3r)-3-hydroxy cis δ9-hexadecenoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a (3r)-3-hydroxy cis δ9-hexadecenoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.