Difference between revisions of "SJ07982"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADP ADP] == * common-name: ** adp * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op...")
(Created page with "Category:gene == Gene SJ18074 == * transcription-direction: ** negative * right-end-position: ** 232299 * left-end-position: ** 220067 * centisome-position: ** 87.03805...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADP ADP] ==
+
== Gene SJ18074 ==
* common-name:
+
* transcription-direction:
** adp
+
** negative
* smiles:
+
* right-end-position:
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op(=o)([o-])[o-])([o-])=o
+
** 232299
* inchi-key:
+
* left-end-position:
** xtwytfmlzfpyci-kqynxxcusa-k
+
** 220067
* molecular-weight:
+
* centisome-position:
** 424.18
+
** 87.03805   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
 +
* [[S.japonica_sterols_curated]]
 +
== Reaction(s) associated ==
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
* [[2.7.11.14-RXN]]
+
* [[3.1.1.64-RXN]]
* [[2.7.11.15-RXN]]
+
** Category: [[annotation]]
* [[2.7.11.16-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[2.7.11.18-RXN]]
+
* [[3.1.1.75-RXN]]
* [[2.7.11.24-RXN]]
+
** Category: [[annotation]]
* [[2.7.11.25-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[2.7.11.30-RXN]]
+
* [[CARBOXYLESTERASE-RXN]]
* [[2.7.11.4-RXN]]
+
** Category: [[annotation]]
* [[2.7.11.7-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[2.7.12.1-RXN]]
+
* [[RETINYL-PALMITATE-ESTERASE-RXN]]
* [[2.7.12.2-RXN]]
+
** Category: [[annotation]]
* [[2.7.4.10-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[3.6.4.5-RXN]]
+
* [[RXN-10711]]
* [[5.99.1.3-RXN]]
+
** Category: [[annotation]]
* [[ACETYLGLUTKIN-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[ACOACXr]]
+
* [[RXN-10767]]
* [[ADENYLYLSULFKIN-RXN]]
+
** Category: [[annotation]]
* [[ADP-DEAMINASE-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[ADPREDUCT-RXN]]
+
* [[RXN-12252]]
* [[ASPARTATEKIN-RXN]]
+
** Category: [[annotation]]
* [[ATP-ADENYLYLTRANSFERASE-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[ATPSYN-RXN]]
+
* [[RXN-12575]]
* [[ATP_LPAREN_3h_RPAREN_th]]
+
** Category: [[annotation]]
* [[ATP_LPAREN_3h_RPAREN_tm]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[CREATINE-KINASE-RXN]]
+
* [[RXNQT-4366]]
* [[Cut1]]
+
** Category: [[annotation]]
* [[DAOTO]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[FORMATETHFLIG-RXN]]
 
* [[GALACTOKIN-RXN]]
 
* [[GLYCEROL-KIN-RXN]]
 
* [[MEVALONATE-KINASE-RXN]]
 
* [[PANTETHEINE-KINASE-RXN]]
 
* [[PCr]]
 
* [[PEPDEPHOS-RXN]]
 
* [[PHOSGLYPHOS-RXN]]
 
* [[PHOSPHOMEVALONATE-KINASE-RXN]]
 
* [[PHOSPHORIBULOKINASE-RXN]]
 
* [[POLYNUCLEOTIDE-5-HYDROXYL-KINASE-RXN]]
 
* [[PROPIONYL-COA-CARBOXY-RXN]]
 
* [[R00157]]
 
* [[RNA-POLYMERASE-SUBUNIT-KINASE-RXN]]
 
* [[RXN-10038]]
 
* [[RXN-10068]]
 
* [[RXN-10862]]
 
* [[RXN-10948]]
 
* [[RXN-12003]]
 
* [[RXN-13139]]
 
* [[RXN-13197]]
 
* [[RXN-14120]]
 
* [[RXN-14228]]
 
* [[RXN-14906]]
 
* [[RXN-15712]]
 
* [[RXN-16294]]
 
* [[RXN-16317]]
 
* [[RXN-17924]]
 
* [[RXN-4305]]
 
* [[RXN-7186]]
 
* [[RXN0-1061]]
 
* [[RXN0-747]]
 
* [[SHIKIMATE-KINASE-RXN]]
 
* [[SUCCCOASYN-RXN]]
 
* [[TAU-PROTEIN-KINASE-RXN]]
 
 
</div>
 
</div>
== Reaction(s) known to produce the compound ==
+
== Pathway(s) associated ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[PWY-6303]]
* [[1-PHOSPHATIDYLINOSITOL-3-KINASE-RXN]]
+
** '''1''' reactions found over '''2''' reactions in the full pathway
* [[1-PHOSPHATIDYLINOSITOL-KINASE-RXN]]
+
* [[PWY-6857]]
* [[2.7.1.127-RXN]]
+
** '''3''' reactions found over '''7''' reactions in the full pathway
* [[2.7.1.133-RXN]]
+
{{#set: transcription-direction=negative}}
* [[2.7.1.134-RXN]]
+
{{#set: right-end-position=232299}}
* [[2.7.1.139-RXN]]
+
{{#set: left-end-position=220067}}
* [[2.7.1.140-RXN]]
+
{{#set: centisome-position=87.03805    }}
* [[2.7.1.148-RXN]]
+
{{#set: organism associated=S.japonica_sterols_curated}}
* [[2.7.1.150-RXN]]
+
{{#set: nb reaction associated=9}}
* [[2.7.1.151-RXN]]
+
{{#set: nb pathway associated=2}}
* [[2.7.1.152-RXN]]
 
* [[2.7.1.68-RXN]]
 
* [[2.7.10.1-RXN]]
 
* [[2.7.11.14-RXN]]
 
* [[2.7.11.15-RXN]]
 
* [[2.7.11.16-RXN]]
 
* [[2.7.11.18-RXN]]
 
* [[2.7.11.2-RXN]]
 
* [[2.7.11.24-RXN]]
 
* [[2.7.11.25-RXN]]
 
* [[2.7.11.30-RXN]]
 
* [[2.7.11.4-RXN]]
 
* [[2.7.11.7-RXN]]
 
* [[2.7.12.1-RXN]]
 
* [[2.7.12.2-RXN]]
 
* [[2.7.13.3-RXN]]
 
* [[2.7.4.10-RXN]]
 
* [[2.7.4.24-RXN]]
 
* [[3.6.1.41-RXN]]
 
* [[3.6.3.1-RXN]]
 
* [[3.6.3.12-RXN]]
 
* [[3.6.3.16-RXN]]
 
* [[3.6.3.30-RXN]]
 
* [[3.6.3.31-RXN]]
 
* [[3.6.3.35-RXN]]
 
* [[3.6.3.37-RXN]]
 
* [[3.6.3.4-RXN]]
 
* [[3.6.3.43-RXN]]
 
* [[3.6.3.44-RXN]]
 
* [[3.6.3.6-RXN]]
 
* [[3.6.3.8-RXN]]
 
* [[3.6.3.9-RXN]]
 
* [[3.6.4.3-RXN]]
 
* [[3.6.4.4-RXN]]
 
* [[3.6.4.5-RXN]]
 
* [[3.6.4.6-RXN]]
 
* [[3.6.4.7-RXN]]
 
* [[4.2.1.93-RXN]]
 
* [[5-FORMYL-THF-CYCLO-LIGASE-RXN]]
 
* [[5-OXOPROLINASE-ATP-HYDROLYSING-RXN]]
 
* [[5.99.1.3-RXN]]
 
* [[6-PHOSPHOFRUCTO-2-KINASE-RXN]]
 
* [[6.3.2.25-RXN]]
 
* [[6.3.5.6-RXN]]
 
* [[6.3.5.7-RXN]]
 
* [[6PFRUCTPHOS-RXN]]
 
* [[ABC-24-RXN]]
 
* [[ABC-25-RXN]]
 
* [[ACETYL-COA-CARBOXYLTRANSFER-RXN]]
 
* [[ACETYLGLUTKIN-RXN]]
 
* [[ADCPT]]
 
* [[ADENOSINE-KINASE-RXN]]
 
* [[ADENYL-KIN-RXN]]
 
* [[ADENYLYLSULFKIN-RXN]]
 
* [[ADNK]]
 
* [[ADNKm]]
 
* [[ADP-DEAMINASE-RXN]]
 
* [[AGK]]
 
* [[AGPT]]
 
* [[AIRS-RXN]]
 
* [[AN2PT]]
 
* [[ARPT]]
 
* [[ASPARTATEKIN-RXN]]
 
* [[ATAM]]
 
* [[ATCD]]
 
* [[ATCDm]]
 
* [[ATCM]]
 
* [[ATCY]]
 
* [[ATDAM]]
 
* [[ATDCD]]
 
* [[ATDCDm]]
 
* [[ATDCM]]
 
* [[ATDGD]]
 
* [[ATDGM]]
 
* [[ATDTD]]
 
* [[ATDTDm]]
 
* [[ATDTM]]
 
* [[ATDUD]]
 
* [[ATDUDm]]
 
* [[ATGD]]
 
* [[ATID]]
 
* [[ATIDm]]
 
* [[ATP-ADENYLYLTRANSFERASE-RXN]]
 
* [[ATP-CITRATE-PRO-S--LYASE-RXN]]
 
* [[ATPASE-RXN]]
 
* [[ATPCL]]
 
* [[ATPSYN-RXN]]
 
* [[ATP_LPAREN_3h_RPAREN_th]]
 
* [[ATP_LPAREN_3h_RPAREN_tm]]
 
* [[ATUD]]
 
* [[ATUDm]]
 
* [[AUPT]]
 
* [[BIOTIN-CARBOXYL-RXN]]
 
* [[BIS5-ADENOSYL-TRIPHOSPHATASE-RXN]]
 
* [[CARBPSYN-RXN]]
 
* [[CDPKIN-RXN]]
 
* [[CHOLINE-KINASE-RXN]]
 
* [[CREATINE-KINASE-RXN]]
 
* [[CTPSYN-RXN]]
 
* [[DADPKIN-RXN]]
 
* [[DALADALALIG-RXN]]
 
* [[DCDPKIN-RXN]]
 
* [[DEOXYADENYLATE-KINASE-RXN]]
 
* [[DEPHOSPHOCOAKIN-RXN]]
 
* [[DETHIOBIOTIN-SYN-RXN]]
 
* [[DGDPKIN-RXN]]
 
* [[DIACYLGLYKIN-RXN]]
 
* [[DIHYDROFOLATESYNTH-RXN]]
 
* [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]]
 
* [[DTDPKIN-RXN]]
 
* [[DTMPKI-RXN]]
 
* [[DUDPKIN-RXN]]
 
* [[ETHANOLAMINE-KINASE-RXN]]
 
* [[FE3abch]]
 
* [[FGAMSYN-RXN]]
 
* [[FOLYLPOLYGLUTAMATESYNTH-RXN]]
 
* [[FORMATETHFLIG-RXN]]
 
* [[FORMYLTHFGLUSYNTH-RXN]]
 
* [[FRUCTOKINASE-RXN]]
 
* [[FTHFL]]
 
* [[FUCOKINASE-RXN]]
 
* [[GALACTOKIN-RXN]]
 
* [[GDPKIN-RXN]]
 
* [[GLUCOKIN-RXN]]
 
* [[GLUCONOKIN-RXN]]
 
* [[GLUTAMINESYN-RXN]]
 
* [[GLUTATHIONE-SYN-RXN]]
 
* [[GLUTCYSLIG-RXN]]
 
* [[GLUTKIN-RXN]]
 
* [[GLY3KIN-RXN]]
 
* [[GLYCEROL-KIN-RXN]]
 
* [[GLYCERONE-KINASE-RXN]]
 
* [[GLYRIBONUCSYN-RXN]]
 
* [[GUANYL-KIN-RXN]]
 
* [[HEXOKINASE-RXN]]
 
* [[HOMOSERKIN-RXN]]
 
* [[MANNKIN-RXN]]
 
* [[MANNKIN-RXN-CPD-12601/ATP//MANNOSE-6P/ADP/PROTON.37.]]
 
* [[MANNKIN-RXN-D-mannopyranose/ATP//MANNOSE-6P/ADP/PROTON.43.]]
 
* [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]]
 
* [[MEVALONATE-KINASE-RXN]]
 
* [[NAD-KIN-RXN]]
 
* [[NADH-KINASE-RXN]]
 
* [[NDPK]]
 
* [[NDPKm]]
 
* [[NICOTINATEPRIBOSYLTRANS-RXN]]
 
* [[NUCLEOSIDE-DIP-KIN-RXN]]
 
* [[OHMETPYRKIN-RXN]]
 
* [[PANTETHEINE-KINASE-RXN]]
 
* [[PANTOTHENATE-KIN-RXN]]
 
* [[PCr]]
 
* [[PEPCARBOXYKIN-RXN]]
 
* [[PFK_]]
 
* [[PHOSGLYPHOS-RXN]]
 
* [[PHOSPHOMEVALONATE-KINASE-RXN]]
 
* [[PHOSPHORIBULOKINASE-RXN]]
 
* [[PNKIN-RXN]]
 
* [[POLYNUCLEOTIDE-5-HYDROXYL-KINASE-RXN]]
 
* [[PROPIONYL-COA-CARBOXY-RXN]]
 
* [[PROTEIN-KINASE-RXN]]
 
* [[PSEUDOURIDINE-KINASE-RXN]]
 
* [[PYRAMKIN-RXN]]
 
* [[PYRIDOXKIN-RXN]]
 
* [[PYRIMSYN3-RXN]]
 
* [[PYRUVATE-CARBOXYLASE-RXN]]
 
* [[R00157]]
 
* [[RIBOFLAVINKIN-RXN]]
 
* [[RIBOKIN-RXN]]
 
* [[RNA-POLYMERASE-SUBUNIT-KINASE-RXN]]
 
* [[RXN-10038]]
 
* [[RXN-10068]]
 
* [[RXN-10948]]
 
* [[RXN-10971]]
 
* [[RXN-10972]]
 
* [[RXN-10973]]
 
* [[RXN-10974]]
 
* [[RXN-10979]]
 
* [[RXN-11109]]
 
* [[RXN-11135]]
 
* [[RXN-11136]]
 
* [[RXN-11376]]
 
* [[RXN-11832]]
 
* [[RXN-12002]]
 
* [[RXN-12003]]
 
* [[RXN-12005]]
 
* [[RXN-13139]]
 
* [[RXN-13197]]
 
* [[RXN-13202]]
 
* [[RXN-14120]]
 
* [[RXN-14196]]
 
* [[RXN-14223]]
 
* [[RXN-14228]]
 
* [[RXN-14325]]
 
* [[RXN-14455]]
 
* [[RXN-14906]]
 
* [[RXN-15005]]
 
* [[RXN-16291]]
 
* [[RXN-16292]]
 
* [[RXN-16293]]
 
* [[RXN-16294]]
 
* [[RXN-16317]]
 
* [[RXN-16909]]
 
* [[RXN-16991]]
 
* [[RXN-6341]]
 
* [[RXN-7162]]
 
* [[RXN-7163]]
 
* [[RXN-7184]]
 
* [[RXN-7186]]
 
* [[RXN-7614]]
 
* [[RXN-7913]]
 
* [[RXN-8443]]
 
* [[RXN0-1061]]
 
* [[RXN0-2921]]
 
* [[RXN0-4261]]
 
* [[RXN1F-20]]
 
* [[RXN1G-4355]]
 
* [[RXN3DJ-11417]]
 
* [[RXN3O-458]]
 
* [[SAICARSYN-RXN]]
 
* [[SHIKIMATE-KINASE-RXN]]
 
* [[SPHINGANINE-KINASE-RXN]]
 
* [[SUCCCOASYN-RXN]]
 
* [[SULFATE-ADENYLYLTRANSFERASE-ADP-RXN]]
 
* [[TAGAKIN-RXN]]
 
* [[TAU-PROTEIN-KINASE-RXN]]
 
* [[THIAZOLSYN3-RXN]]
 
* [[TRANS-RXN-193]]
 
* [[TRANS-RXN-2]]
 
* [[TRANS-RXN-311]]
 
* [[TRIOKINASE-RXN]]
 
* [[UDPKIN-RXN]]
 
* [[URIDINEKIN-RXN]]
 
* [[XYLULOKIN-RXN]]
 
</div>
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=adp}}
 
{{#set: inchi-key=inchikey=xtwytfmlzfpyci-kqynxxcusa-k}}
 
{{#set: molecular-weight=424.18}}
 

Revision as of 20:22, 18 December 2020

Gene SJ18074

  • transcription-direction:
    • negative
  • right-end-position:
    • 232299
  • left-end-position:
    • 220067
  • centisome-position:
    • 87.03805

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-6303
    • 1 reactions found over 2 reactions in the full pathway
  • PWY-6857
    • 3 reactions found over 7 reactions in the full pathway