Difference between revisions of "SJ07990"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE-P THIAMINE-P] == * common-name: ** thiamine phosphate * smiles: ** cc1([n+](=csc(ccop(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE] == * common-name: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE-P THIAMINE-P] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE] ==
 
* common-name:
 
* common-name:
** thiamine phosphate
+
** 2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate
 
* smiles:
 
* smiles:
** cc1([n+](=csc(ccop([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccocc(cop([o-])([o-])=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c
 
* inchi-key:
 
* inchi-key:
** hzsajdvwzrbgif-uhfffaoysa-m
+
** whmxlrrvaneoog-mvfiekmpsa-l
 
* molecular-weight:
 
* molecular-weight:
** 343.317
+
** 715.004
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-3542]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12610]]
+
* [[2.5.1.42-RXN]]
* [[RXN-12611]]
 
* [[RXN0-3542]]
 
* [[THI-P-SYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=thiamine phosphate}}
+
{{#set: common-name=2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate}}
{{#set: inchi-key=inchikey=hzsajdvwzrbgif-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=whmxlrrvaneoog-mvfiekmpsa-l}}
{{#set: molecular-weight=343.317}}
+
{{#set: molecular-weight=715.004}}

Revision as of 14:19, 26 August 2019

Metabolite BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE

  • common-name:
    • 2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=ccocc(cop([o-])([o-])=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c
  • inchi-key:
    • whmxlrrvaneoog-mvfiekmpsa-l
  • molecular-weight:
    • 715.004

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality