Difference between revisions of "SJ07990"

Revision as of 09:24, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARNITINE CARNITINE] ==
 * common-name:
-** 2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate
+** l-carnitine
 * smiles:
-** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccocc(cop([o-])([o-])=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c
+** c(c(o)cc(=o)[o-])[n+](c)(c)c
 * inchi-key:
-** whmxlrrvaneoog-mvfiekmpsa-l
+** phiqhxfuzvpyii-zcfiwibfsa-n
 * molecular-weight:
-** 715.004
+** 161.2
 == Reaction(s) known to consume the compound ==
+* [[CARNITINE-O-ACETYLTRANSFERASE-RXN]]
+* [[CARNITINE-O-PALMITOYLTRANSFERASE-RXN]]
+* [[RXN-9918]]
 == Reaction(s) known to produce the compound ==
-* [[2.5.1.42-RXN]]
+* [[1.14.11.1-RXN]]
+* [[CARNITINE-O-ACETYLTRANSFERASE-RXN]]
+* [[CARNITINE-O-PALMITOYLTRANSFERASE-RXN]]
+* [[RXN-9918]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate}}
+{{#set: common-name=l-carnitine}}
-{{#set: inchi-key=inchikey=whmxlrrvaneoog-mvfiekmpsa-l}}
+{{#set: inchi-key=inchikey=phiqhxfuzvpyii-zcfiwibfsa-n}}
-{{#set: molecular-weight=715.004}}
+{{#set: molecular-weight=161.2}}