Difference between revisions of "SJ07990"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARNITINE CARNITINE] == * common-name: ** l-carnitine * smiles: ** c(c(o)cc(=o)[o-])[n+](c)(c)c...")
(Created page with "Category:gene == Gene SJ03994 == * transcription-direction: ** negative * right-end-position: ** 170712 * left-end-position: ** 150853 * centisome-position: ** 29.093277...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARNITINE CARNITINE] ==
+
== Gene SJ03994 ==
* common-name:
+
* transcription-direction:
** l-carnitine
+
** negative
* smiles:
+
* right-end-position:
** c(c(o)cc(=o)[o-])[n+](c)(c)c
+
** 170712
* inchi-key:
+
* left-end-position:
** phiqhxfuzvpyii-zcfiwibfsa-n
+
** 150853
* molecular-weight:
+
* centisome-position:
** 161.2
+
** 29.093277   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[CARNITINE-O-ACETYLTRANSFERASE-RXN]]
+
* [[S.japonica_sterols_curated]]
* [[CARNITINE-O-PALMITOYLTRANSFERASE-RXN]]
+
== Reaction(s) associated ==
* [[RXN-9918]]
+
* [[RXN-11841]]
== Reaction(s) known to produce the compound ==
+
** Category: [[annotation]]
* [[1.14.11.1-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[CARNITINE-O-ACETYLTRANSFERASE-RXN]]
+
* [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]]
* [[CARNITINE-O-PALMITOYLTRANSFERASE-RXN]]
+
** Category: [[annotation]]
* [[RXN-9918]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
== Reaction(s) of unknown directionality ==
+
** Category: [[orthology]]
{{#set: common-name=l-carnitine}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
{{#set: inchi-key=inchikey=phiqhxfuzvpyii-zcfiwibfsa-n}}
+
{{#set: transcription-direction=negative}}
{{#set: molecular-weight=161.2}}
+
{{#set: right-end-position=170712}}
 +
{{#set: left-end-position=150853}}
 +
{{#set: centisome-position=29.093277    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=2}}

Revision as of 20:20, 18 December 2020

Gene SJ03994

  • transcription-direction:
    • negative
  • right-end-position:
    • 170712
  • left-end-position:
    • 150853
  • centisome-position:
    • 29.093277

Organism(s) associated with this gene

Reaction(s) associated