Difference between revisions of "SJ08012"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19148 CPD-19148] == * common-name: ** (5z)-dodecenoyl-coa * smiles: ** ccccccc=ccccc(=o)scc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Plasmanylcholine Plasmanylcholine] == * common-name: ** a plasmanylcholine == Reaction(s) known...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19148 CPD-19148] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Plasmanylcholine Plasmanylcholine] ==
 
* common-name:
 
* common-name:
** (5z)-dodecenoyl-coa
+
** a plasmanylcholine
* smiles:
 
** ccccccc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** rcvjzgbrlgutkt-cggpsvllsa-j
 
* molecular-weight:
 
** 943.792
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17796]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17795]]
+
* [[RXN-17733]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(5z)-dodecenoyl-coa}}
+
{{#set: common-name=a plasmanylcholine}}
{{#set: inchi-key=inchikey=rcvjzgbrlgutkt-cggpsvllsa-j}}
 
{{#set: molecular-weight=943.792}}
 

Revision as of 09:24, 27 August 2019

Metabolite Plasmanylcholine

  • common-name:
    • a plasmanylcholine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality