Difference between revisions of "SJ08024"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-497 CPD-497] == * common-name: ** pseudouridine * smiles: ** c1(nc(=o)nc(=o)c=1c2(oc(co)c(o...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10280 CPD-10280] == * common-name: ** lignoceroyl-coa * smiles: ** cccccccccccccccccccccccc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-497 CPD-497] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10280 CPD-10280] ==
 
* common-name:
 
* common-name:
** pseudouridine
+
** lignoceroyl-coa
 
* smiles:
 
* smiles:
** c1(nc(=o)nc(=o)c=1c2(oc(co)c(o)c(o)2))
+
** cccccccccccccccccccccccc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
 
* inchi-key:
 
* inchi-key:
** ptjwiqphwpfnbw-gbndhiklsa-n
+
** moymqyzwiukggy-jbkavqfisa-j
 
* molecular-weight:
 
* molecular-weight:
** 244.204
+
** 1114.129
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PSEUDOURIDINE-KINASE-RXN]]
+
* [[ACECOATRANS-RXN-CPD-10280/ACET//TETRACOSANOATE/ACETYL-COA.42.]]
* [[RXN-15703]]
+
* [[RXN-13296]]
 +
* [[RXN-16415-TETRACOSANOATE/ATP/CO-A//CPD-10280/AMP/PPI.43.]]
 +
* [[THIOESTER-RXN[CCO-CYTOSOL]-CPD-10280/WATER//TETRACOSANOATE/CO-A/PROTON.57.]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15703]]
+
* [[RXN-13308]]
 +
* [[RXN-16415-TETRACOSANOATE/ATP/CO-A//CPD-10280/AMP/PPI.43.]]
 +
* [[TRANS-2-ENOYL-COA-REDUCTASE-NAD+-RXN-CPD-10280/NAD//CPD-14282/NADH/PROTON.37.]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pseudouridine}}
+
{{#set: common-name=lignoceroyl-coa}}
{{#set: inchi-key=inchikey=ptjwiqphwpfnbw-gbndhiklsa-n}}
+
{{#set: inchi-key=inchikey=moymqyzwiukggy-jbkavqfisa-j}}
{{#set: molecular-weight=244.204}}
+
{{#set: molecular-weight=1114.129}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-10280

  • common-name:
    • lignoceroyl-coa
  • smiles:
    • cccccccccccccccccccccccc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
  • inchi-key:
    • moymqyzwiukggy-jbkavqfisa-j
  • molecular-weight:
    • 1114.129

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality