Difference between revisions of "SJ08074"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9646 CPD-9646] == * common-name: ** di-trans,octa-cis-undecaprenyl phosphate * smiles: ** c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=A-LIPID-HYDROPEROXIDE A-LIPID-HYDROPEROXIDE] == * common-name: ** a hydroperoxy-fatty-acyl-[lip...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9646 CPD-9646] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=A-LIPID-HYDROPEROXIDE A-LIPID-HYDROPEROXIDE] ==
 
* common-name:
 
* common-name:
** di-trans,octa-cis-undecaprenyl phosphate
+
** a hydroperoxy-fatty-acyl-[lipid]
* smiles:
 
** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])[o-])c)c)c
 
* inchi-key:
 
** ufphfkctoziafy-ntdveaecsa-l
 
* molecular-weight:
 
** 845.279
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PHOSNACMURPENTATRANS-RXN]]
+
* [[1.11.1.12-RXN]]
* [[RXN-11347]]
 
* [[RXN-8975]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8975]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=di-trans,octa-cis-undecaprenyl phosphate}}
+
{{#set: common-name=a hydroperoxy-fatty-acyl-[lipid]}}
{{#set: inchi-key=inchikey=ufphfkctoziafy-ntdveaecsa-l}}
 
{{#set: molecular-weight=845.279}}
 

Revision as of 09:24, 27 August 2019

Metabolite A-LIPID-HYDROPEROXIDE

  • common-name:
    • a hydroperoxy-fatty-acyl-[lipid]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a hydroperoxy-fatty-acyl-[lipid" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.