Difference between revisions of "SJ08089"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-IDONATE L-IDONATE] == * common-name: ** l-idonate * smiles: ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-]...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-Substituted-Amino-Acids N-Substituted-Amino-Acids] == * common-name: ** an n-modified amino a...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-IDONATE L-IDONATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-Substituted-Amino-Acids N-Substituted-Amino-Acids] ==
 
* common-name:
 
* common-name:
** l-idonate
+
** an n-modified amino acid
* smiles:
 
** c(o)c(o)c(o)c(o)c(o)c(=o)[o-]
 
* inchi-key:
 
** rghnjxzeokukbd-sknvomklsa-m
 
* molecular-weight:
 
** 195.149
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12107]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[AMINOCYL-TRNA-HYDROLASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-idonate}}
+
{{#set: common-name=an n-modified amino acid}}
{{#set: inchi-key=inchikey=rghnjxzeokukbd-sknvomklsa-m}}
 
{{#set: molecular-weight=195.149}}
 

Revision as of 09:24, 27 August 2019

Metabolite N-Substituted-Amino-Acids

  • common-name:
    • an n-modified amino acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality