Difference between revisions of "SJ08158"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHYLBUT-CPD METHYLBUT-CPD] == * common-name: ** 2-methylbutanal * smiles: ** ccc(c)[ch]=o * i...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LYS LYS] == * common-name: ** l-lysine * smiles: ** c([n+])cccc([n+])c([o-])=o * inchi-key: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LYS LYS] == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-lysine |
* smiles: | * smiles: | ||
| − | ** | + | ** c([n+])cccc([n+])c([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** kdxkernsbixsrk-yfkpbyrvsa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 147.197 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[LYSINE--TRNA-LIGASE-RXN]] |
| + | * [[LYSINE-N-ACETYLTRANSFERASE-RXN]] | ||
| + | * [[RXN-1961]] | ||
| + | * [[biomass_rxn]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[DIAMINOPIMDECARB-RXN]] | ||
| + | * [[LYSINE-N-ACETYLTRANSFERASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-lysine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kdxkernsbixsrk-yfkpbyrvsa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=147.197}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite LYS
- common-name:
- l-lysine
- smiles:
- c([n+])cccc([n+])c([o-])=o
- inchi-key:
- kdxkernsbixsrk-yfkpbyrvsa-o
- molecular-weight:
- 147.197
