Difference between revisions of "SJ08182"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15691 CPD-15691] == * common-name: ** (5e)-3-oxo-dodec-5-enoyl-coa * smiles: ** ccccccc=ccc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Linoleoyl-groups Linoleoyl-groups] == * common-name: ** a [glycerolipid]-linoleate == Reaction(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15691 CPD-15691] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Linoleoyl-groups Linoleoyl-groups] ==
 
* common-name:
 
* common-name:
** (5e)-3-oxo-dodec-5-enoyl-coa
+
** a [glycerolipid]-linoleate
* smiles:
 
** ccccccc=ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** vklhslowdwgvgp-woabmhmmsa-j
 
* molecular-weight:
 
** 957.775
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14803]]
+
* [[1.14.99.33-RXN]]
 +
* [[RXN-11680]]
 +
* [[RXN-16045]]
 +
* [[RXN-16046]]
 +
* [[RXN-9667]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-9669]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(5e)-3-oxo-dodec-5-enoyl-coa}}
+
{{#set: common-name=a [glycerolipid]-linoleate}}
{{#set: inchi-key=inchikey=vklhslowdwgvgp-woabmhmmsa-j}}
 
{{#set: molecular-weight=957.775}}
 

Revision as of 09:24, 27 August 2019

Metabolite Linoleoyl-groups

  • common-name:
    • a [glycerolipid]-linoleate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [glycerolipid]-linoleate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.